C14H20F4N4O — CID 133372632
1-(4-methylpiperazin-1-yl)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propan-2-ol (PubChem CID 133372632) has the molecular formula C14H20F4N4O and a molecular weight of 336.33 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propan-2-ol.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 133372632 |
| Molecular Formula | C14H20F4N4O |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propan-2-ol |
| SMILES | CN1CCN(CC(O)CN(C)c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C14H20F4N4O/c1-20-3-5-22(6-4-20)8-9(23)7-21(2)12-10(15)13(17)19-14(18)11(12)16/h9,23H,3-8H2,1-2H3 |
| InChIKey | PQKVPXRDICRXJP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|