C13H21Cl2N3 — CID 103190605
2-N-[3-chloro-5-(chloromethyl)-2-pyridinyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 103190605) has the molecular formula C13H21Cl2N3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-N-[3-chloro-5-(chloromethyl)-2-pyridinyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[3-chloro-5-(chloromethyl)-2-pyridinyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103190605 |
| Molecular Formula | C13H21Cl2N3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-N-[3-chloro-5-(chloromethyl)-2-pyridinyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(c1ncc(CCl)cc1Cl)C(C)CN(C)C |
| InChI | InChI=1S/C13H21Cl2N3/c1-5-18(10(2)9-17(3)4)13-12(15)6-11(7-14)8-16-13/h6,8,10H,5,7,9H2,1-4H3 |
| InChIKey | OSVGFDAZJZSVAU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|