C11H24N4 — CID 103190875
2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanenitrile (PubChem CID 103190875) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanenitrile.
| Compound Name | 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 103190875 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)(N)C#N)C(C)CN(C)C |
| InChI | InChI=1S/C11H24N4/c1-6-15(9-11(3,13)8-12)10(2)7-14(4)5/h10H,6-7,9,13H2,1-5H3 |
| InChIKey | PVGBLEUISTUWAC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |