C11H25N3O2 — CID 103190936
2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanoic acid (PubChem CID 103190936) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103190936 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 2-amino-3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)(N)C(=O)O)C(C)CN(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-6-14(9(2)7-13(4)5)8-11(3,12)10(15)16/h9H,6-8,12H2,1-5H3,(H,15,16) |
| InChIKey | DVQQWDCFIGSMRC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |