C16H35N3O2 — CID 103190949
ethyl 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propan-2-ylamino)propanoate (PubChem CID 103190949) has the molecular formula C16H35N3O2 and a molecular weight of 301.48 g/mol. Its IUPAC name is ethyl 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propan-2-ylamino)propanoate.
| Compound Name | ethyl 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 103190949 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | ethyl 3-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propan-2-ylamino)propanoate |
| SMILES | CCOC(=O)C(C)(CN(CC)C(C)CN(C)C)NC(C)C |
| InChI | InChI=1S/C16H35N3O2/c1-9-19(14(5)11-18(7)8)12-16(6,17-13(3)4)15(20)21-10-2/h13-14,17H,9-12H2,1-8H3 |
| InChIKey | BWKMCCBGIQXDJC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |