C10H23N3O — CID 103190759
2-[1-(dimethylamino)propan-2-yl-ethylamino]propanamide (PubChem CID 103190759) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[1-(dimethylamino)propan-2-yl-ethylamino]propanamide.
| Compound Name | 2-[1-(dimethylamino)propan-2-yl-ethylamino]propanamide |
|---|---|
| PubChem CID | 103190759 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 2-[1-(dimethylamino)propan-2-yl-ethylamino]propanamide |
| SMILES | CCN(C(C)CN(C)C)C(C)C(N)=O |
| InChI | InChI=1S/C10H23N3O/c1-6-13(9(3)10(11)14)8(2)7-12(4)5/h8-9H,6-7H2,1-5H3,(H2,11,14) |
| InChIKey | XSYYGVUMAOPKPJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |