C16H28FN3O — CID 103191427
3-[1-(dimethylamino)propan-2-yl-ethylamino]-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-ol (PubChem CID 103191427) has the molecular formula C16H28FN3O and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-[1-(dimethylamino)propan-2-yl-ethylamino]-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-ol.
| Compound Name | 3-[1-(dimethylamino)propan-2-yl-ethylamino]-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 103191427 |
| Molecular Formula | C16H28FN3O |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 3-[1-(dimethylamino)propan-2-yl-ethylamino]-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-ol |
| SMILES | CCN(CC(C)C(O)c1ccc(F)cn1)C(C)CN(C)C |
| InChI | InChI=1S/C16H28FN3O/c1-6-20(13(3)11-19(4)5)10-12(2)16(21)15-8-7-14(17)9-18-15/h7-9,12-13,16,21H,6,10-11H2,1-5H3 |
| InChIKey | NGXFOFRHQYZJOS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |