C15H25FN2O — CID 112586417
1-(5-fluoro-2-pyridinyl)-2-methyl-3-[methyl(2-methylbutan-2-yl)amino]propan-1-ol (PubChem CID 112586417) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-2-methyl-3-[methyl(2-methylbutan-2-yl)amino]propan-1-ol.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-2-methyl-3-[methyl(2-methylbutan-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 112586417 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-2-methyl-3-[methyl(2-methylbutan-2-yl)amino]propan-1-ol |
| SMILES | CCC(C)(C)N(C)CC(C)C(O)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H25FN2O/c1-6-15(3,4)18(5)10-11(2)14(19)13-8-7-12(16)9-17-13/h7-9,11,14,19H,6,10H2,1-5H3 |
| InChIKey | DNUZWJVZNDZVMI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |