C14H32N4O2S — CID 103192345
N-[1-(dimethylamino)propan-2-yl]-N-ethyl-4-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 103192345) has the molecular formula C14H32N4O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-N-ethyl-4-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-4-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 103192345 |
| Molecular Formula | C14H32N4O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-4-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)N1CCC(CNC)CC1 |
| InChI | InChI=1S/C14H32N4O2S/c1-6-18(13(2)12-16(4)5)21(19,20)17-9-7-14(8-10-17)11-15-3/h13-15H,6-12H2,1-5H3 |
| InChIKey | UVCQTHOJQGJBKD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |