C10H23ClN2O3S — CID 119977573
1-[1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119977573) has the molecular formula C10H23ClN2O3S and a molecular weight of 286.82 g/mol. Its IUPAC name is 1-[1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119977573 |
| Molecular Formula | C10H23ClN2O3S |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCN(S(=O)(=O)C(C)COC)C1.Cl |
| InChI | InChI=1S/C10H22N2O3S.ClH/c1-9(8-15-3)16(13,14)12-5-4-10(7-12)6-11-2;/h9-11H,4-8H2,1-3H3;1H |
| InChIKey | ZZQJJPGBLAOUFY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |