C12H27ClN2O3S — CID 119990322
N-[[1-(1-methoxypropan-2-ylsulfonyl)piperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 119990322) has the molecular formula C12H27ClN2O3S and a molecular weight of 314.88 g/mol. Its IUPAC name is N-[[1-(1-methoxypropan-2-ylsulfonyl)piperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-(1-methoxypropan-2-ylsulfonyl)piperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119990322 |
| Molecular Formula | C12H27ClN2O3S |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[[1-(1-methoxypropan-2-ylsulfonyl)piperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(S(=O)(=O)C(C)COC)CC1.Cl |
| InChI | InChI=1S/C12H26N2O3S.ClH/c1-4-13-9-12-5-7-14(8-6-12)18(15,16)11(2)10-17-3;/h11-13H,4-10H2,1-3H3;1H |
| InChIKey | KXDAMEYAUIEAEI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |