C10H20F2N2O3S — CID 55258397
N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-2-methoxyethanamine (PubChem CID 55258397) has the molecular formula C10H20F2N2O3S and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 55258397 |
| Molecular Formula | C10H20F2N2O3S |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1CCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C10H20F2N2O3S/c1-17-7-4-13-8-9-2-5-14(6-3-9)18(15,16)10(11)12/h9-10,13H,2-8H2,1H3 |
| InChIKey | NBUDGYMEHLLDNR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|