C15H27F2N5O3S — CID 119160245
4-acetyl-N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 119160245) has the molecular formula C15H27F2N5O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-acetyl-N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119160245 |
| Molecular Formula | C15H27F2N5O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-acetyl-N-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)F)CC1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C15H27F2N5O3S/c1-12(23)20-7-9-21(10-8-20)15(18-2)19-11-13-3-5-22(6-4-13)26(24,25)14(16)17/h13-14H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | WNTXCXLFTDXHDL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|