C12H20F2N2O6S — CID 154865668
3-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methylamino]-2-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 154865668) has the molecular formula C12H20F2N2O6S and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methylamino]-2-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methylamino]-2-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 154865668 |
| Molecular Formula | C12H20F2N2O6S |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methylamino]-2-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(C)(C(=O)O)C(=O)NCC1CCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C12H20F2N2O6S/c1-12(22-2,10(18)19)9(17)15-7-8-3-5-16(6-4-8)23(20,21)11(13)14/h8,11H,3-7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | DGFSMYLKGQXIEM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|