C14H30ClN3O2S — CID 119990742
N-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 119990742) has the molecular formula C14H30ClN3O2S and a molecular weight of 339.93 g/mol. Its IUPAC name is N-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119990742 |
| Molecular Formula | C14H30ClN3O2S |
| Molecular Weight | 339.93 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(S(=O)(=O)N2CCC(C)CC2)CC1.Cl |
| InChI | InChI=1S/C14H29N3O2S.ClH/c1-3-15-12-14-6-10-17(11-7-14)20(18,19)16-8-4-13(2)5-9-16;/h13-15H,3-12H2,1-2H3;1H |
| InChIKey | PVKBQWHHIASURT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.93 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |