C8H19ClN2O3S — CID 119962481
(3R)-1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 119962481) has the molecular formula C8H19ClN2O3S and a molecular weight of 258.77 g/mol. Its IUPAC name is (3R)-1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962481 |
| Molecular Formula | C8H19ClN2O3S |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (3R)-1-(1-methoxypropan-2-ylsulfonyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | COCC(C)S(=O)(=O)N1CC[C@@H](N)C1.Cl |
| InChI | InChI=1S/C8H18N2O3S.ClH/c1-7(6-13-2)14(11,12)10-4-3-8(9)5-10;/h7-8H,3-6,9H2,1-2H3;1H/t7?,8-;/m1./s1 |
| InChIKey | MFKNWLPHPZSYDQ-LTTWWRRRSA-N |
| XLogP | -0.19 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |