C14H27N3O2S2 — CID 103192356
N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-[2-(methylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 103192356) has the molecular formula C14H27N3O2S2 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-[2-(methylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-[2-(methylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103192356 |
| Molecular Formula | C14H27N3O2S2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-[2-(methylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)c1ccc(CCNC)s1 |
| InChI | InChI=1S/C14H27N3O2S2/c1-6-17(12(2)11-16(4)5)21(18,19)14-8-7-13(20-14)9-10-15-3/h7-8,12,15H,6,9-11H2,1-5H3 |
| InChIKey | CTQYYYOJWPGKLV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |