C11H27N5O — CID 103192666
3-amino-1-[1-(dimethylamino)propan-2-yl]-1-ethyl-2-(2-methoxyethyl)guanidine (PubChem CID 103192666) has the molecular formula C11H27N5O and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-amino-1-[1-(dimethylamino)propan-2-yl]-1-ethyl-2-(2-methoxyethyl)guanidine.
| Compound Name | 3-amino-1-[1-(dimethylamino)propan-2-yl]-1-ethyl-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 103192666 |
| Molecular Formula | C11H27N5O |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 3-amino-1-[1-(dimethylamino)propan-2-yl]-1-ethyl-2-(2-methoxyethyl)guanidine |
| SMILES | CCN(/C(=N/CCOC)NN)C(C)CN(C)C |
| InChI | InChI=1S/C11H27N5O/c1-6-16(10(2)9-15(3)4)11(14-12)13-7-8-17-5/h10H,6-9,12H2,1-5H3,(H,13,14) |
| InChIKey | XSAGRHFAPMYAMB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|