C8H18F2N4O — CID 104888973
3-amino-1-(2,2-difluoroethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine (PubChem CID 104888973) has the molecular formula C8H18F2N4O and a molecular weight of 224.25 g/mol. Its IUPAC name is 3-amino-1-(2,2-difluoroethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine.
| Compound Name | 3-amino-1-(2,2-difluoroethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 104888973 |
| Molecular Formula | C8H18F2N4O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-amino-1-(2,2-difluoroethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine |
| SMILES | COCC(C)/N=C(/NN)N(C)CC(F)F |
| InChI | InChI=1S/C8H18F2N4O/c1-6(5-15-3)12-8(13-11)14(2)4-7(9)10/h6-7H,4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | WLNSSSGRUTZMPO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|