C12H20F3N3O — CID 103194767
1-(3-amino-1,1,1-trifluoropentan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194767) has the molecular formula C12H20F3N3O and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluoropentan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(3-amino-1,1,1-trifluoropentan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194767 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluoropentan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CCC(N)C(N1CCCC2C(=O)NCC21)C(F)(F)F |
| InChI | InChI=1S/C12H20F3N3O/c1-2-8(16)10(12(13,14)15)18-5-3-4-7-9(18)6-17-11(7)19/h7-10H,2-6,16H2,1H3,(H,17,19) |
| InChIKey | MJFZRSVJWATLLY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |