C11H18F3N3O — CID 103194878
1-(3-amino-1,1,1-trifluorobutan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194878) has the molecular formula C11H18F3N3O and a molecular weight of 265.28 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194878 |
| Molecular Formula | C11H18F3N3O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluorobutan-2-yl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(N)C(N1CCCC2C(=O)NCC21)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O/c1-6(15)9(11(12,13)14)17-4-2-3-7-8(17)5-16-10(7)18/h6-9H,2-5,15H2,1H3,(H,16,18) |
| InChIKey | ALCDPWIYXWPLHU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |