C11H21N3O — CID 103194956
1-(4-aminobutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194956) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(4-aminobutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194956 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(4-aminobutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | NCCCCN1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C11H21N3O/c12-5-1-2-6-14-7-3-4-9-10(14)8-13-11(9)15/h9-10H,1-8,12H2,(H,13,15) |
| InChIKey | KEPMJBAPYDXLNU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|