C19H12F6N2O2 — CID 10319590
N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylbenzamide (PubChem CID 10319590) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylbenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 10319590 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(-n2cccc2)ccc1O |
| InChI | InChI=1S/C19H12F6N2O2/c20-18(21,22)11-7-12(19(23,24)25)9-13(8-11)26-17(29)15-10-14(3-4-16(15)28)27-5-1-2-6-27/h1-10,28H,(H,26,29) |
| InChIKey | MLSHOVOUZVUGJR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |