C21H21N3O4 — CID 10499929
5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 10499929) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 10499929 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxy-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccccn1)c1cc(NCc2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C21H21N3O4/c25-17-5-7-19(26)14(11-17)13-24-16-4-6-20(27)18(12-16)21(28)23-10-8-15-3-1-2-9-22-15/h1-7,9,11-12,24-27H,8,10,13H2,(H,23,28) |
| InChIKey | HDBUXOHSMWIMJN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|