C14H27BrN2O — CID 103197800
1-[2-(bromomethyl)-3,3-dimethylbutyl]-N-methylpiperidine-3-carboxamide (PubChem CID 103197800) has the molecular formula C14H27BrN2O and a molecular weight of 319.29 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103197800 |
| Molecular Formula | C14H27BrN2O |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(CC(CBr)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H27BrN2O/c1-14(2,3)12(8-15)10-17-7-5-6-11(9-17)13(18)16-4/h11-12H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | UZGNXXPHQHEEIL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|