C10H20N2O2 — CID 143767660
1-(2-methoxyethyl)-N-methylpiperidine-3-carboxamide (PubChem CID 143767660) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 143767660 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(2-methoxyethyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(CCOC)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-11-10(13)9-4-3-5-12(8-9)6-7-14-2/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | ADPVIYICIASMFN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |