C12H26N2O2 — CID 143678079
ethane;1-(2-methoxyethyl)-N-methylpiperidine-4-carboxamide (PubChem CID 143678079) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;1-(2-methoxyethyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | ethane;1-(2-methoxyethyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 143678079 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | ethane;1-(2-methoxyethyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CC.CNC(=O)C1CCN(CCOC)CC1 |
| InChI | InChI=1S/C10H20N2O2.C2H6/c1-11-10(13)9-3-5-12(6-4-9)7-8-14-2;1-2/h9H,3-8H2,1-2H3,(H,11,13);1-2H3 |
| InChIKey | ZUYMCGQBVFFCQE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |