C15H20N2O2S — CID 103199638
methyl 2-(2-adamantyl)-5-amino-1,3-thiazole-4-carboxylate (PubChem CID 103199638) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl 2-(2-adamantyl)-5-amino-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-adamantyl)-5-amino-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103199638 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 2-(2-adamantyl)-5-amino-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C2C3CC4CC(C3)CC2C4)sc1N |
| InChI | InChI=1S/C15H20N2O2S/c1-19-15(18)12-13(16)20-14(17-12)11-9-3-7-2-8(5-9)6-10(11)4-7/h7-11H,2-6,16H2,1H3 |
| InChIKey | HRXLHFUHSOCABP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |