C15H13N3O2 — CID 103200747
ethyl 5-phenylimidazo[1,2-a]pyrimidine-2-carboxylate (PubChem CID 103200747) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl 5-phenylimidazo[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-phenylimidazo[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 103200747 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | ethyl 5-phenylimidazo[1,2-a]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(-c3ccccc3)ccnc2n1 |
| InChI | InChI=1S/C15H13N3O2/c1-2-20-14(19)12-10-18-13(8-9-16-15(18)17-12)11-6-4-3-5-7-11/h3-10H,2H2,1H3 |
| InChIKey | UCZXGCGMCZCPIL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |