ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate

C14H12N4O2 — CID 46900211

IUPACethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cc(-c2ccccc2)n2ncnc2n1
InChIInChI=1S/C14H12N4O2/c1-2-20-13(19)11-8-12(10-6-4-3-5-7-10)18-14(17-11)15-9-16-18/h3-9H,2H2,1H3
InChIKeyUCOICENJIPDNCM-UHFFFAOYSA-N
MW268.28 g/mol
LogP1.97
Rot. Bonds3

About ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate

ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 46900211) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate.

Molecular Properties

Compound Nameethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate
PubChem CID46900211
Molecular FormulaC14H12N4O2
Molecular Weight268.28 g/mol
Exact Mass268.10
IUPAC Nameethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate
SMILESCCOC(=O)c1cc(-c2ccccc2)n2ncnc2n1
InChIInChI=1S/C14H12N4O2/c1-2-20-13(19)11-8-12(10-6-4-3-5-7-10)18-14(17-11)15-9-16-18/h3-9H,2H2,1H3
InChIKeyUCOICENJIPDNCM-UHFFFAOYSA-N
XLogP1.97
TPSA69.38 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.28
LogP ≤ 51.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate (CID 46900211) is ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate is CCOC(=O)c1cc(-c2ccccc2)n2ncnc2n1.
What is the InChIKey of ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate?
The InChIKey is UCOICENJIPDNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-2-20-13(19)11-8-12(10-6-4-3-5-7-10)18-14(17-11)15-9-16-18/h3-9H,2H2,1H3.
What are the key properties of ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate?
ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate has a molecular weight of 268.28 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate is sourced from PubChem (CID 46900211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).