About ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate
ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate (PubChem CID 14850356) has the molecular formula C8H7ClN4O2
and a molecular weight of 226.62 g/mol. Its IUPAC name is ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate.
Analyze ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate?
The IUPAC name of ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate (CID 14850356) is ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate.
What is the SMILES notation for ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate?
The canonical SMILES for ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate is CCOC(=O)c1cc(Cl)nc2ncnn12.
What is the InChIKey of ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate?
The InChIKey is OWEDTLUVFFYAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O2/c1-2-15-7(14)5-3-6(9)12-8-10-4-11-13(5)8/h3-4H,2H2,1H3.
What are the key properties of ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate?
ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate has a molecular weight of 226.62 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylate is sourced from PubChem (CID 14850356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).