C13H17N5O2 — CID 139049380
ethyl (E)-3-(dimethylamino)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)prop-2-enoate (PubChem CID 139049380) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is ethyl (E)-3-(dimethylamino)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(dimethylamino)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 139049380 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | ethyl (E)-3-(dimethylamino)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/N(C)C)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C13H17N5O2/c1-5-20-12(19)10(7-17(3)4)11-6-9(2)16-13-14-8-15-18(11)13/h6-8H,5H2,1-4H3/b10-7+ |
| InChIKey | OTSHYWWBGPBWRH-JXMROGBWSA-N |
| XLogP | 0.90 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|