C9H10N4O — CID 70298005
7-(1-methoxyethenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 70298005) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 7-(1-methoxyethenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(1-methoxyethenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 70298005 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 7-(1-methoxyethenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=C(OC)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C9H10N4O/c1-6-4-8(7(2)14-3)13-9(12-6)10-5-11-13/h4-5H,2H2,1,3H3 |
| InChIKey | OXNAVKXQHUCMKX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|