C15H17N3O2 — CID 103202497
4-[(3,4-dimethoxyanilino)methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103202497) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyanilino)methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[(3,4-dimethoxyanilino)methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103202497 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-[(3,4-dimethoxyanilino)methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | COc1ccc(NCc2cc(C#N)n(C)c2)cc1OC |
| InChI | InChI=1S/C15H17N3O2/c1-18-10-11(6-13(18)8-16)9-17-12-4-5-14(19-2)15(7-12)20-3/h4-7,10,17H,9H2,1-3H3 |
| InChIKey | WMJXIFHSEAXGEW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|