C14H13N5O — CID 103202567
1-methyl-4-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]pyrrole-2-carbonitrile (PubChem CID 103202567) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-methyl-4-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1-methyl-4-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103202567 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-methyl-4-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cn1cc(CNc2ccc3[nH]c(=O)[nH]c3c2)cc1C#N |
| InChI | InChI=1S/C14H13N5O/c1-19-8-9(4-11(19)6-15)7-16-10-2-3-12-13(5-10)18-14(20)17-12/h2-5,8,16H,7H2,1H3,(H2,17,18,20) |
| InChIKey | DQQCIYMUSOUJQW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|