C17H22N4 — CID 103202564
4-[[[2-(dimethylamino)-2-phenylethyl]amino]methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103202564) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[[[2-(dimethylamino)-2-phenylethyl]amino]methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[[[2-(dimethylamino)-2-phenylethyl]amino]methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103202564 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-[[[2-(dimethylamino)-2-phenylethyl]amino]methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | CN(C)C(CNCc1cc(C#N)n(C)c1)c1ccccc1 |
| InChI | InChI=1S/C17H22N4/c1-20(2)17(15-7-5-4-6-8-15)12-19-11-14-9-16(10-18)21(3)13-14/h4-9,13,17,19H,11-12H2,1-3H3 |
| InChIKey | MBKXMWRGNUXFFU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |