C11H17N3O2 — CID 103203040
4-[(2,2-dimethoxyethylamino)methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103203040) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-[(2,2-dimethoxyethylamino)methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[(2,2-dimethoxyethylamino)methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103203040 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 4-[(2,2-dimethoxyethylamino)methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | COC(CNCc1cc(C#N)n(C)c1)OC |
| InChI | InChI=1S/C11H17N3O2/c1-14-8-9(4-10(14)5-12)6-13-7-11(15-2)16-3/h4,8,11,13H,6-7H2,1-3H3 |
| InChIKey | CIKRXXOBMFSXRV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 59.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|