C10H12BrN3 — CID 103203579
4-[(2-bromoprop-2-enylamino)methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103203579) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 4-[(2-bromoprop-2-enylamino)methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[(2-bromoprop-2-enylamino)methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103203579 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 4-[(2-bromoprop-2-enylamino)methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | C=C(Br)CNCc1cc(C#N)n(C)c1 |
| InChI | InChI=1S/C10H12BrN3/c1-8(11)5-13-6-9-3-10(4-12)14(2)7-9/h3,7,13H,1,5-6H2,2H3 |
| InChIKey | CUWJAZDTDGWMKB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |