C12H17N3 — CID 103203606
1-methyl-4-[[(1-methylcyclobutyl)amino]methyl]pyrrole-2-carbonitrile (PubChem CID 103203606) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-methyl-4-[[(1-methylcyclobutyl)amino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1-methyl-4-[[(1-methylcyclobutyl)amino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103203606 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-methyl-4-[[(1-methylcyclobutyl)amino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cn1cc(CNC2(C)CCC2)cc1C#N |
| InChI | InChI=1S/C12H17N3/c1-12(4-3-5-12)14-8-10-6-11(7-13)15(2)9-10/h6,9,14H,3-5,8H2,1-2H3 |
| InChIKey | JWXZVQCKLSMWKY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |