C12H17N3O2 — CID 103202916
methyl 2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]-2-methylpropanoate (PubChem CID 103202916) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is methyl 2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 103202916 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | methyl 2-[(5-cyano-1-methylpyrrol-3-yl)methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NCc1cc(C#N)n(C)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2,11(16)17-4)14-7-9-5-10(6-13)15(3)8-9/h5,8,14H,7H2,1-4H3 |
| InChIKey | MJECSCVORLJAQC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |