C14H19N5S — CID 103203922
3-[1,2,4-benzotriazin-3-yl(2-methylpropyl)amino]propanethioamide (PubChem CID 103203922) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 3-[1,2,4-benzotriazin-3-yl(2-methylpropyl)amino]propanethioamide.
| Compound Name | 3-[1,2,4-benzotriazin-3-yl(2-methylpropyl)amino]propanethioamide |
|---|---|
| PubChem CID | 103203922 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[1,2,4-benzotriazin-3-yl(2-methylpropyl)amino]propanethioamide |
| SMILES | CC(C)CN(CCC(N)=S)c1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H19N5S/c1-10(2)9-19(8-7-13(15)20)14-16-11-5-3-4-6-12(11)17-18-14/h3-6,10H,7-9H2,1-2H3,(H2,15,20) |
| InChIKey | JQHPOTQIDSQKHF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|