C12H16N6O — CID 103203991
3-[1,2,4-benzotriazin-3-yl(ethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 103203991) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-[1,2,4-benzotriazin-3-yl(ethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[1,2,4-benzotriazin-3-yl(ethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103203991 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-[1,2,4-benzotriazin-3-yl(ethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC/C(N)=N/O)c1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H16N6O/c1-2-18(8-7-11(13)17-19)12-14-9-5-3-4-6-10(9)15-16-12/h3-6,19H,2,7-8H2,1H3,(H2,13,17) |
| InChIKey | XBYLXUKSZWNJKI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|