C11H11F3N2O4 — CID 103205666
3-amino-4-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]benzoic acid (PubChem CID 103205666) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 3-amino-4-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]benzoic acid.
| Compound Name | 3-amino-4-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 103205666 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-amino-4-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O4/c12-11(13,14)5-20-4-9(17)16-8-2-1-6(10(18)19)3-7(8)15/h1-3H,4-5,15H2,(H,16,17)(H,18,19) |
| InChIKey | APZKXCBSFBNREC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|