C10H9F5N2O2 — CID 103205716
N-(2-amino-4,6-difluorophenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103205716) has the molecular formula C10H9F5N2O2 and a molecular weight of 284.18 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103205716 |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Nc1cc(F)cc(F)c1NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C10H9F5N2O2/c11-5-1-6(12)9(7(16)2-5)17-8(18)3-19-4-10(13,14)15/h1-2H,3-4,16H2,(H,17,18) |
| InChIKey | YIBNWOXQWJEAJE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|