C10H13F2N3O — CID 81310656
3-(2-amino-4,6-difluorophenyl)-1-ethyl-1-methylurea (PubChem CID 81310656) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(2-amino-4,6-difluorophenyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(2-amino-4,6-difluorophenyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 81310656 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-(2-amino-4,6-difluorophenyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1c(N)cc(F)cc1F |
| InChI | InChI=1S/C10H13F2N3O/c1-3-15(2)10(16)14-9-7(12)4-6(11)5-8(9)13/h4-5H,3,13H2,1-2H3,(H,14,16) |
| InChIKey | VRECKVANQHXGSF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|