C14H20F2N2O — CID 81314143
N-(2-amino-4,6-difluorophenyl)octanamide (PubChem CID 81314143) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)octanamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)octanamide |
|---|---|
| PubChem CID | 81314143 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1c(N)cc(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-2-3-4-5-6-7-13(19)18-14-11(16)8-10(15)9-12(14)17/h8-9H,2-7,17H2,1H3,(H,18,19) |
| InChIKey | DOUHHEDSMRMURJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|