About 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid
4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid (PubChem CID 103205968) has the molecular formula C12H18F3NO4
and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid |
| PubChem CID | 103205968 |
| Molecular Formula | C12H18F3NO4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(C(=O)COCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F3NO4/c1-2-11(10(18)19)3-5-16(6-4-11)9(17)7-20-8-12(13,14)15/h2-8H2,1H3,(H,18,19) |
| InChIKey | YXWHLRUESAIILK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid?
The IUPAC name of 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid (CID 103205968) is 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid?
The canonical SMILES for 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid is CCC1(C(=O)O)CCN(C(=O)COCC(F)(F)F)CC1.
What is the InChIKey of 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid?
The InChIKey is YXWHLRUESAIILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO4/c1-2-11(10(18)19)3-5-16(6-4-11)9(17)7-20-8-12(13,14)15/h2-8H2,1H3,(H,18,19).
What are the key properties of 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid?
4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid has a molecular weight of 297.27 g/mol, XLogP of 1.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-[2-(2,2,2-trifluoroethoxy)acetyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 103205968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).