C12H20F3NO — CID 103207503
1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 103207503) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103207503 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C12H20F3NO/c1-2-16-11(8-17-9-12(13,14)15)10-6-4-3-5-7-10/h6,11,16H,2-5,7-9H2,1H3 |
| InChIKey | JZBWBRJQBPVNSY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|