C13H23F2NO — CID 103207504
1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine (PubChem CID 103207504) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine.
| Compound Name | 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 103207504 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)-N-ethylpropan-1-amine |
| SMILES | CCNC(CCOCC(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C13H23F2NO/c1-2-16-12(8-9-17-10-13(14)15)11-6-4-3-5-7-11/h6,12-13,16H,2-5,7-10H2,1H3 |
| InChIKey | RWIJFQGPGRHTCZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|