C13H22F3NO — CID 55061872
N-[2-(cyclohexen-1-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 55061872) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 55061872 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | FC(F)(F)COCCCNCCC1=CCCCC1 |
| InChI | InChI=1S/C13H22F3NO/c14-13(15,16)11-18-10-4-8-17-9-7-12-5-2-1-3-6-12/h5,17H,1-4,6-11H2 |
| InChIKey | PNHSIFFVWOGLKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|